C25H35N3O3 — CID 89472592
(3R)-4-amino-3-[[(4-octylphenyl)-phenylcarbamoyl]amino]butanoic acid (PubChem CID 89472592) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is (3R)-4-amino-3-[[(4-octylphenyl)-phenylcarbamoyl]amino]butanoic acid.
| Compound Name | (3R)-4-amino-3-[[(4-octylphenyl)-phenylcarbamoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 89472592 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | (3R)-4-amino-3-[[(4-octylphenyl)-phenylcarbamoyl]amino]butanoic acid |
| SMILES | CCCCCCCCc1ccc(N(C(=O)N[C@@H](CN)CC(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H35N3O3/c1-2-3-4-5-6-8-11-20-14-16-23(17-15-20)28(22-12-9-7-10-13-22)25(31)27-21(19-26)18-24(29)30/h7,9-10,12-17,21H,2-6,8,11,18-19,26H2,1H3,(H,27,31)(H,29,30)/t21-/m1/s1 |
| InChIKey | VCHMPCCKVVZPDV-OAQYLSRUSA-N |
| XLogP | 5.24 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|