C20H27N2O4+ — CID 68747094
[3-carboxy-2-[[5-(2-phenylethyl)furan-2-carbonyl]amino]propyl]-trimethylazanium (PubChem CID 68747094) has the molecular formula C20H27N2O4+ and a molecular weight of 359.45 g/mol. Its IUPAC name is [3-carboxy-2-[[5-(2-phenylethyl)furan-2-carbonyl]amino]propyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[[5-(2-phenylethyl)furan-2-carbonyl]amino]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 68747094 |
| Molecular Formula | C20H27N2O4+ |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | [3-carboxy-2-[[5-(2-phenylethyl)furan-2-carbonyl]amino]propyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(CC(=O)O)NC(=O)c1ccc(CCc2ccccc2)o1 |
| InChI | InChI=1S/C20H26N2O4/c1-22(2,3)14-16(13-19(23)24)21-20(25)18-12-11-17(26-18)10-9-15-7-5-4-6-8-15/h4-8,11-12,16H,9-10,13-14H2,1-3H3,(H-,21,23,24,25)/p+1 |
| InChIKey | QRUMKEYDKWZJIQ-UHFFFAOYSA-O |
| XLogP | 2.34 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|