C22H28N2O3 — CID 25064258
(3R)-3-[[3-(2-phenylethyl)benzoyl]amino]-4-(trimethylazaniumyl)butanoate (PubChem CID 25064258) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is (3R)-3-[[3-(2-phenylethyl)benzoyl]amino]-4-(trimethylazaniumyl)butanoate.
| Compound Name | (3R)-3-[[3-(2-phenylethyl)benzoyl]amino]-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 25064258 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | (3R)-3-[[3-(2-phenylethyl)benzoyl]amino]-4-(trimethylazaniumyl)butanoate |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)[O-])NC(=O)c1cccc(CCc2ccccc2)c1 |
| InChI | InChI=1S/C22H28N2O3/c1-24(2,3)16-20(15-21(25)26)23-22(27)19-11-7-10-18(14-19)13-12-17-8-5-4-6-9-17/h4-11,14,20H,12-13,15-16H2,1-3H3,(H-,23,25,26,27)/t20-/m1/s1 |
| InChIKey | WSVAAOUWQINHHB-HXUWFJFHSA-N |
| XLogP | 1.42 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|