C18H24N4O3S — CID 68743729
3-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)carbamoylamino]-4-(trimethylazaniumyl)butanoate (PubChem CID 68743729) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is 3-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)carbamoylamino]-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)carbamoylamino]-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 68743729 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 3-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)carbamoylamino]-4-(trimethylazaniumyl)butanoate |
| SMILES | Cc1nc(-c2ccccc2)sc1NC(=O)NC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C18H24N4O3S/c1-12-16(26-17(19-12)13-8-6-5-7-9-13)21-18(25)20-14(10-15(23)24)11-22(2,3)4/h5-9,14H,10-11H2,1-4H3,(H2-,20,21,23,24,25) |
| InChIKey | YGSAVJGVBDPMDE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 94.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|