C19H21N5O2S — CID 166313285
N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-N'-(4-methyl-2-phenyl-1,3-thiazol-5-yl)oxamide (PubChem CID 166313285) has the molecular formula C19H21N5O2S and a molecular weight of 383.48 g/mol. Its IUPAC name is N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-N'-(4-methyl-2-phenyl-1,3-thiazol-5-yl)oxamide.
| Compound Name | N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-N'-(4-methyl-2-phenyl-1,3-thiazol-5-yl)oxamide |
|---|---|
| PubChem CID | 166313285 |
| Molecular Formula | C19H21N5O2S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-N'-(4-methyl-2-phenyl-1,3-thiazol-5-yl)oxamide |
| SMILES | Cc1nc(-c2ccccc2)sc1NC(=O)C(=O)NCCn1cnc(C)c1C |
| InChI | InChI=1S/C19H21N5O2S/c1-12-14(3)24(11-21-12)10-9-20-16(25)17(26)23-18-13(2)22-19(27-18)15-7-5-4-6-8-15/h4-8,11H,9-10H2,1-3H3,(H,20,25)(H,23,26) |
| InChIKey | IWELADBDUYBVHE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|