About N-[2-(4,5-dimethylimidazol-1-yl)ethyl]aniline
N-[2-(4,5-dimethylimidazol-1-yl)ethyl]aniline (PubChem CID 62565856) has the molecular formula C13H17N3
and a molecular weight of 215.30 g/mol. Its IUPAC name is N-[2-(4,5-dimethylimidazol-1-yl)ethyl]aniline.
Molecular Properties
| Compound Name | N-[2-(4,5-dimethylimidazol-1-yl)ethyl]aniline |
| PubChem CID | 62565856 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | N-[2-(4,5-dimethylimidazol-1-yl)ethyl]aniline |
| SMILES | Cc1ncn(CCNc2ccccc2)c1C |
| InChI | InChI=1S/C13H17N3/c1-11-12(2)16(10-15-11)9-8-14-13-6-4-3-5-7-13/h3-7,10,14H,8-9H2,1-2H3 |
| InChIKey | UMUKARSJPPNNGR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(4,5-dimethylimidazol-1-yl)ethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4,5-dimethylimidazol-1-yl)ethyl]aniline?
The IUPAC name of N-[2-(4,5-dimethylimidazol-1-yl)ethyl]aniline (CID 62565856) is N-[2-(4,5-dimethylimidazol-1-yl)ethyl]aniline.
What is the SMILES notation for N-[2-(4,5-dimethylimidazol-1-yl)ethyl]aniline?
The canonical SMILES for N-[2-(4,5-dimethylimidazol-1-yl)ethyl]aniline is Cc1ncn(CCNc2ccccc2)c1C.
What is the InChIKey of N-[2-(4,5-dimethylimidazol-1-yl)ethyl]aniline?
The InChIKey is UMUKARSJPPNNGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3/c1-11-12(2)16(10-15-11)9-8-14-13-6-4-3-5-7-13/h3-7,10,14H,8-9H2,1-2H3.
What are the key properties of N-[2-(4,5-dimethylimidazol-1-yl)ethyl]aniline?
N-[2-(4,5-dimethylimidazol-1-yl)ethyl]aniline has a molecular weight of 215.30 g/mol, XLogP of 2.61, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4,5-dimethylimidazol-1-yl)ethyl]aniline is sourced from PubChem (CID 62565856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).