C13H18N4 — CID 62567738
2-(4,5-dimethylimidazol-1-yl)-N-(pyridin-2-ylmethyl)ethanamine (PubChem CID 62567738) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-(4,5-dimethylimidazol-1-yl)-N-(pyridin-2-ylmethyl)ethanamine.
| Compound Name | 2-(4,5-dimethylimidazol-1-yl)-N-(pyridin-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 62567738 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2-(4,5-dimethylimidazol-1-yl)-N-(pyridin-2-ylmethyl)ethanamine |
| SMILES | Cc1ncn(CCNCc2ccccn2)c1C |
| InChI | InChI=1S/C13H18N4/c1-11-12(2)17(10-16-11)8-7-14-9-13-5-3-4-6-15-13/h3-6,10,14H,7-9H2,1-2H3 |
| InChIKey | JEHCWLCDGVNGOZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|