C12H14N4O2 — CID 62564407
1-[2-(pyridin-2-ylmethylamino)ethyl]pyrimidine-2,4-dione (PubChem CID 62564407) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 1-[2-(pyridin-2-ylmethylamino)ethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[2-(pyridin-2-ylmethylamino)ethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 62564407 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 1-[2-(pyridin-2-ylmethylamino)ethyl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn(CCNCc2ccccn2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H14N4O2/c17-11-4-7-16(12(18)15-11)8-6-13-9-10-3-1-2-5-14-10/h1-5,7,13H,6,8-9H2,(H,15,17,18) |
| InChIKey | FBOZCELCAZOHHQ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|