C15H14F2N4 — CID 62564103
2-(5,6-difluorobenzimidazol-1-yl)-N-(pyridin-2-ylmethyl)ethanamine (PubChem CID 62564103) has the molecular formula C15H14F2N4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 2-(5,6-difluorobenzimidazol-1-yl)-N-(pyridin-2-ylmethyl)ethanamine.
| Compound Name | 2-(5,6-difluorobenzimidazol-1-yl)-N-(pyridin-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 62564103 |
| Molecular Formula | C15H14F2N4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 2-(5,6-difluorobenzimidazol-1-yl)-N-(pyridin-2-ylmethyl)ethanamine |
| SMILES | Fc1cc2ncn(CCNCc3ccccn3)c2cc1F |
| InChI | InChI=1S/C15H14F2N4/c16-12-7-14-15(8-13(12)17)21(10-20-14)6-5-18-9-11-3-1-2-4-19-11/h1-4,7-8,10,18H,5-6,9H2 |
| InChIKey | OPLPFJULHOZSFR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|