About 3-chloro-N-[2-(5,6-difluorobenzimidazol-1-yl)ethyl]aniline
3-chloro-N-[2-(5,6-difluorobenzimidazol-1-yl)ethyl]aniline (PubChem CID 62564430) has the molecular formula C15H12ClF2N3
and a molecular weight of 307.73 g/mol. Its IUPAC name is 3-chloro-N-[2-(5,6-difluorobenzimidazol-1-yl)ethyl]aniline.
Molecular Properties
| Compound Name | 3-chloro-N-[2-(5,6-difluorobenzimidazol-1-yl)ethyl]aniline |
| PubChem CID | 62564430 |
| Molecular Formula | C15H12ClF2N3 |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 3-chloro-N-[2-(5,6-difluorobenzimidazol-1-yl)ethyl]aniline |
| SMILES | Fc1cc2ncn(CCNc3cccc(Cl)c3)c2cc1F |
| InChI | InChI=1S/C15H12ClF2N3/c16-10-2-1-3-11(6-10)19-4-5-21-9-20-14-7-12(17)13(18)8-15(14)21/h1-3,6-9,19H,4-5H2 |
| InChIKey | UIIXBHUQXQOUKL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-N-[2-(5,6-difluorobenzimidazol-1-yl)ethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[2-(5,6-difluorobenzimidazol-1-yl)ethyl]aniline?
The IUPAC name of 3-chloro-N-[2-(5,6-difluorobenzimidazol-1-yl)ethyl]aniline (CID 62564430) is 3-chloro-N-[2-(5,6-difluorobenzimidazol-1-yl)ethyl]aniline.
What is the SMILES notation for 3-chloro-N-[2-(5,6-difluorobenzimidazol-1-yl)ethyl]aniline?
The canonical SMILES for 3-chloro-N-[2-(5,6-difluorobenzimidazol-1-yl)ethyl]aniline is Fc1cc2ncn(CCNc3cccc(Cl)c3)c2cc1F.
What is the InChIKey of 3-chloro-N-[2-(5,6-difluorobenzimidazol-1-yl)ethyl]aniline?
The InChIKey is UIIXBHUQXQOUKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClF2N3/c16-10-2-1-3-11(6-10)19-4-5-21-9-20-14-7-12(17)13(18)8-15(14)21/h1-3,6-9,19H,4-5H2.
What are the key properties of 3-chloro-N-[2-(5,6-difluorobenzimidazol-1-yl)ethyl]aniline?
3-chloro-N-[2-(5,6-difluorobenzimidazol-1-yl)ethyl]aniline has a molecular weight of 307.73 g/mol, XLogP of 4.08, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[2-(5,6-difluorobenzimidazol-1-yl)ethyl]aniline is sourced from PubChem (CID 62564430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).