C15H11ClF2N2O — CID 110884989
1-(4-chlorophenyl)-2-(5,6-difluorobenzimidazol-1-yl)ethanol (PubChem CID 110884989) has the molecular formula C15H11ClF2N2O and a molecular weight of 308.72 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(5,6-difluorobenzimidazol-1-yl)ethanol.
| Compound Name | 1-(4-chlorophenyl)-2-(5,6-difluorobenzimidazol-1-yl)ethanol |
|---|---|
| PubChem CID | 110884989 |
| Molecular Formula | C15H11ClF2N2O |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(5,6-difluorobenzimidazol-1-yl)ethanol |
| SMILES | OC(Cn1cnc2cc(F)c(F)cc21)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H11ClF2N2O/c16-10-3-1-9(2-4-10)15(21)7-20-8-19-13-5-11(17)12(18)6-14(13)20/h1-6,8,15,21H,7H2 |
| InChIKey | IBRKZOVRJZHGIW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |