C13H16N4O2 — CID 62927880
1-methyl-4-[2-(pyridin-2-ylmethylamino)ethyl]pyrazine-2,3-dione (PubChem CID 62927880) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 1-methyl-4-[2-(pyridin-2-ylmethylamino)ethyl]pyrazine-2,3-dione.
| Compound Name | 1-methyl-4-[2-(pyridin-2-ylmethylamino)ethyl]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 62927880 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 1-methyl-4-[2-(pyridin-2-ylmethylamino)ethyl]pyrazine-2,3-dione |
| SMILES | Cn1ccn(CCNCc2ccccn2)c(=O)c1=O |
| InChI | InChI=1S/C13H16N4O2/c1-16-8-9-17(13(19)12(16)18)7-6-14-10-11-4-2-3-5-15-11/h2-5,8-9,14H,6-7,10H2,1H3 |
| InChIKey | JNDLVUTVZPEQHZ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|