C30H25N7O — CID 10458615
3-pyridin-2-yl-2-[4-[1-[2-(pyridin-2-ylmethylamino)ethyl]imidazol-2-yl]phenyl]quinazolin-4-one (PubChem CID 10458615) has the molecular formula C30H25N7O and a molecular weight of 499.58 g/mol. Its IUPAC name is 3-pyridin-2-yl-2-[4-[1-[2-(pyridin-2-ylmethylamino)ethyl]imidazol-2-yl]phenyl]quinazolin-4-one.
| Compound Name | 3-pyridin-2-yl-2-[4-[1-[2-(pyridin-2-ylmethylamino)ethyl]imidazol-2-yl]phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 10458615 |
| Molecular Formula | C30H25N7O |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 3-pyridin-2-yl-2-[4-[1-[2-(pyridin-2-ylmethylamino)ethyl]imidazol-2-yl]phenyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2ccc(-c3nccn3CCNCc3ccccn3)cc2)n1-c1ccccn1 |
| InChI | InChI=1S/C30H25N7O/c38-30-25-8-1-2-9-26(25)35-29(37(30)27-10-4-6-16-33-27)23-13-11-22(12-14-23)28-34-18-20-36(28)19-17-31-21-24-7-3-5-15-32-24/h1-16,18,20,31H,17,19,21H2 |
| InChIKey | NXKQKOOMIIKGPO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|