C25H25N3O2 — CID 70682957
formic acid;2-(2-phenylimidazol-1-yl)-N-[(4-phenylphenyl)methyl]ethanamine (PubChem CID 70682957) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is formic acid;2-(2-phenylimidazol-1-yl)-N-[(4-phenylphenyl)methyl]ethanamine.
| Compound Name | formic acid;2-(2-phenylimidazol-1-yl)-N-[(4-phenylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 70682957 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | formic acid;2-(2-phenylimidazol-1-yl)-N-[(4-phenylphenyl)methyl]ethanamine |
| SMILES | O=CO.c1ccc(-c2ccc(CNCCn3ccnc3-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H23N3.CH2O2/c1-3-7-21(8-4-1)22-13-11-20(12-14-22)19-25-15-17-27-18-16-26-24(27)23-9-5-2-6-10-23;2-1-3/h1-14,16,18,25H,15,17,19H2;1H,(H,2,3) |
| InChIKey | GASAFJOICKKPMT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|