About 1-benzyl-2-phenylimidazole;formic acid
1-benzyl-2-phenylimidazole;formic acid (PubChem CID 158419728) has the molecular formula C19H20N2O6
and a molecular weight of 372.38 g/mol. Its IUPAC name is 1-benzyl-2-phenylimidazole;formic acid.
Molecular Properties
| Compound Name | 1-benzyl-2-phenylimidazole;formic acid |
| PubChem CID | 158419728 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 1-benzyl-2-phenylimidazole;formic acid |
| SMILES | O=CO.O=CO.O=CO.c1ccc(Cn2ccnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H14N2.3CH2O2/c1-3-7-14(8-4-1)13-18-12-11-17-16(18)15-9-5-2-6-10-15;3*2-1-3/h1-12H,13H2;3*1H,(H,2,3) |
| InChIKey | HAINLOWLWWTPMF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-2-phenylimidazole;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2-phenylimidazole;formic acid?
The IUPAC name of 1-benzyl-2-phenylimidazole;formic acid (CID 158419728) is 1-benzyl-2-phenylimidazole;formic acid.
What is the SMILES notation for 1-benzyl-2-phenylimidazole;formic acid?
The canonical SMILES for 1-benzyl-2-phenylimidazole;formic acid is O=CO.O=CO.O=CO.c1ccc(Cn2ccnc2-c2ccccc2)cc1.
What is the InChIKey of 1-benzyl-2-phenylimidazole;formic acid?
The InChIKey is HAINLOWLWWTPMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2.3CH2O2/c1-3-7-14(8-4-1)13-18-12-11-17-16(18)15-9-5-2-6-10-15;3*2-1-3/h1-12H,13H2;3*1H,(H,2,3).
What are the key properties of 1-benzyl-2-phenylimidazole;formic acid?
1-benzyl-2-phenylimidazole;formic acid has a molecular weight of 372.38 g/mol, XLogP of 2.70, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2-phenylimidazole;formic acid is sourced from PubChem (CID 158419728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).