C27H24ClN5O — CID 10050373
3-(5-chloro-2-pyridinyl)-2-[4-[1-[2-(ethylamino)ethyl]pyrrol-2-yl]phenyl]quinazolin-4-one (PubChem CID 10050373) has the molecular formula C27H24ClN5O and a molecular weight of 469.98 g/mol. Its IUPAC name is 3-(5-chloro-2-pyridinyl)-2-[4-[1-[2-(ethylamino)ethyl]pyrrol-2-yl]phenyl]quinazolin-4-one.
| Compound Name | 3-(5-chloro-2-pyridinyl)-2-[4-[1-[2-(ethylamino)ethyl]pyrrol-2-yl]phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 10050373 |
| Molecular Formula | C27H24ClN5O |
| Molecular Weight | 469.98 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 3-(5-chloro-2-pyridinyl)-2-[4-[1-[2-(ethylamino)ethyl]pyrrol-2-yl]phenyl]quinazolin-4-one |
| SMILES | CCNCCn1cccc1-c1ccc(-c2nc3ccccc3c(=O)n2-c2ccc(Cl)cn2)cc1 |
| InChI | InChI=1S/C27H24ClN5O/c1-2-29-15-17-32-16-5-8-24(32)19-9-11-20(12-10-19)26-31-23-7-4-3-6-22(23)27(34)33(26)25-14-13-21(28)18-30-25/h3-14,16,18,29H,2,15,17H2,1H3 |
| InChIKey | IWVFMELZVBEOCV-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.98 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|