C19H30N4 — CID 102218014
2-(3,5-ditert-butylpyrazol-1-yl)-N-(pyridin-2-ylmethyl)ethanamine (PubChem CID 102218014) has the molecular formula C19H30N4 and a molecular weight of 314.48 g/mol. Its IUPAC name is 2-(3,5-ditert-butylpyrazol-1-yl)-N-(pyridin-2-ylmethyl)ethanamine.
| Compound Name | 2-(3,5-ditert-butylpyrazol-1-yl)-N-(pyridin-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 102218014 |
| Molecular Formula | C19H30N4 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | 2-(3,5-ditert-butylpyrazol-1-yl)-N-(pyridin-2-ylmethyl)ethanamine |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)n(CCNCc2ccccn2)n1 |
| InChI | InChI=1S/C19H30N4/c1-18(2,3)16-13-17(19(4,5)6)23(22-16)12-11-20-14-15-9-7-8-10-21-15/h7-10,13,20H,11-12,14H2,1-6H3 |
| InChIKey | ODBPNRXBJGUHLS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|