About dibromonickel;2-[(3,5-ditert-butylpyrazol-1-yl)methyl]pyridine
dibromonickel;2-[(3,5-ditert-butylpyrazol-1-yl)methyl]pyridine (PubChem CID 139241709) has the molecular formula C17H25Br2N3Ni
and a molecular weight of 489.91 g/mol. Its IUPAC name is dibromonickel;2-[(3,5-ditert-butylpyrazol-1-yl)methyl]pyridine.
Molecular Properties
| Compound Name | dibromonickel;2-[(3,5-ditert-butylpyrazol-1-yl)methyl]pyridine |
| PubChem CID | 139241709 |
| Molecular Formula | C17H25Br2N3Ni |
| Molecular Weight | 489.91 g/mol |
| Exact Mass | 486.98 |
| IUPAC Name | dibromonickel;2-[(3,5-ditert-butylpyrazol-1-yl)methyl]pyridine |
| SMILES | Br[Ni]Br.CC(C)(C)c1cc(C(C)(C)C)n(Cc2ccccn2)n1 |
| InChI | InChI=1S/C17H25N3.2BrH.Ni/c1-16(2,3)14-11-15(17(4,5)6)20(19-14)12-13-9-7-8-10-18-13;;;/h7-11H,12H2,1-6H3;2*1H;/q;;;+2/p-2 |
| InChIKey | KMZXBEJBZCHDJU-UHFFFAOYSA-L |
| XLogP | 5.61 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.91 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dibromonickel;2-[(3,5-ditert-butylpyrazol-1-yl)methyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibromonickel;2-[(3,5-ditert-butylpyrazol-1-yl)methyl]pyridine?
The IUPAC name of dibromonickel;2-[(3,5-ditert-butylpyrazol-1-yl)methyl]pyridine (CID 139241709) is dibromonickel;2-[(3,5-ditert-butylpyrazol-1-yl)methyl]pyridine.
What is the SMILES notation for dibromonickel;2-[(3,5-ditert-butylpyrazol-1-yl)methyl]pyridine?
The canonical SMILES for dibromonickel;2-[(3,5-ditert-butylpyrazol-1-yl)methyl]pyridine is Br[Ni]Br.CC(C)(C)c1cc(C(C)(C)C)n(Cc2ccccn2)n1.
What is the InChIKey of dibromonickel;2-[(3,5-ditert-butylpyrazol-1-yl)methyl]pyridine?
The InChIKey is KMZXBEJBZCHDJU-UHFFFAOYSA-L. The full InChI is InChI=1S/C17H25N3.2BrH.Ni/c1-16(2,3)14-11-15(17(4,5)6)20(19-14)12-13-9-7-8-10-18-13;;;/h7-11H,12H2,1-6H3;2*1H;/q;;;+2/p-2.
What are the key properties of dibromonickel;2-[(3,5-ditert-butylpyrazol-1-yl)methyl]pyridine?
dibromonickel;2-[(3,5-ditert-butylpyrazol-1-yl)methyl]pyridine has a molecular weight of 489.91 g/mol, XLogP of 5.61, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dibromonickel;2-[(3,5-ditert-butylpyrazol-1-yl)methyl]pyridine is sourced from PubChem (CID 139241709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).