About 5-chloro-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-6-methylpyridin-2-amine
5-chloro-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-6-methylpyridin-2-amine (PubChem CID 134703730) has the molecular formula C13H17ClN4
and a molecular weight of 264.76 g/mol. Its IUPAC name is 5-chloro-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-6-methylpyridin-2-amine.
Molecular Properties
| Compound Name | 5-chloro-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-6-methylpyridin-2-amine |
| PubChem CID | 134703730 |
| Molecular Formula | C13H17ClN4 |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 5-chloro-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-6-methylpyridin-2-amine |
| SMILES | Cc1nc(NCCn2cnc(C)c2C)ccc1Cl |
| InChI | InChI=1S/C13H17ClN4/c1-9-11(3)18(8-16-9)7-6-15-13-5-4-12(14)10(2)17-13/h4-5,8H,6-7H2,1-3H3,(H,15,17) |
| InChIKey | VVJDCGYNQXITMW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-6-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-6-methylpyridin-2-amine?
The IUPAC name of 5-chloro-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-6-methylpyridin-2-amine (CID 134703730) is 5-chloro-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-6-methylpyridin-2-amine.
What is the SMILES notation for 5-chloro-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-6-methylpyridin-2-amine?
The canonical SMILES for 5-chloro-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-6-methylpyridin-2-amine is Cc1nc(NCCn2cnc(C)c2C)ccc1Cl.
What is the InChIKey of 5-chloro-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-6-methylpyridin-2-amine?
The InChIKey is VVJDCGYNQXITMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN4/c1-9-11(3)18(8-16-9)7-6-15-13-5-4-12(14)10(2)17-13/h4-5,8H,6-7H2,1-3H3,(H,15,17).
What are the key properties of 5-chloro-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-6-methylpyridin-2-amine?
5-chloro-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-6-methylpyridin-2-amine has a molecular weight of 264.76 g/mol, XLogP of 2.97, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-6-methylpyridin-2-amine is sourced from PubChem (CID 134703730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).