C14H16ClIN4O — CID 66343132
3-[[3-chloro-6-(propylamino)-2-pyridinyl]methyl]-5-iodo-6-methylpyrimidin-4-one (PubChem CID 66343132) has the molecular formula C14H16ClIN4O and a molecular weight of 418.67 g/mol. Its IUPAC name is 3-[[3-chloro-6-(propylamino)-2-pyridinyl]methyl]-5-iodo-6-methylpyrimidin-4-one.
| Compound Name | 3-[[3-chloro-6-(propylamino)-2-pyridinyl]methyl]-5-iodo-6-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 66343132 |
| Molecular Formula | C14H16ClIN4O |
| Molecular Weight | 418.67 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | 3-[[3-chloro-6-(propylamino)-2-pyridinyl]methyl]-5-iodo-6-methylpyrimidin-4-one |
| SMILES | CCCNc1ccc(Cl)c(Cn2cnc(C)c(I)c2=O)n1 |
| InChI | InChI=1S/C14H16ClIN4O/c1-3-6-17-12-5-4-10(15)11(19-12)7-20-8-18-9(2)13(16)14(20)21/h4-5,8H,3,6-7H2,1-2H3,(H,17,19) |
| InChIKey | BATGCPWILZVIRU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.67 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|