C11H8Cl2IN3O — CID 66340007
3-[(3,6-dichloro-2-pyridinyl)methyl]-5-iodo-6-methylpyrimidin-4-one (PubChem CID 66340007) has the molecular formula C11H8Cl2IN3O and a molecular weight of 396.02 g/mol. Its IUPAC name is 3-[(3,6-dichloro-2-pyridinyl)methyl]-5-iodo-6-methylpyrimidin-4-one.
| Compound Name | 3-[(3,6-dichloro-2-pyridinyl)methyl]-5-iodo-6-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 66340007 |
| Molecular Formula | C11H8Cl2IN3O |
| Molecular Weight | 396.02 g/mol |
| Exact Mass | 394.91 |
| IUPAC Name | 3-[(3,6-dichloro-2-pyridinyl)methyl]-5-iodo-6-methylpyrimidin-4-one |
| SMILES | Cc1ncn(Cc2nc(Cl)ccc2Cl)c(=O)c1I |
| InChI | InChI=1S/C11H8Cl2IN3O/c1-6-10(14)11(18)17(5-15-6)4-8-7(12)2-3-9(13)16-8/h2-3,5H,4H2,1H3 |
| InChIKey | JLBYJVBYVUBJGN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.02 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|