C13H12IN5OS — CID 66340892
5-iodo-6-methyl-3-[[4-(methylamino)thieno[2,3-d]pyrimidin-2-yl]methyl]pyrimidin-4-one (PubChem CID 66340892) has the molecular formula C13H12IN5OS and a molecular weight of 413.24 g/mol. Its IUPAC name is 5-iodo-6-methyl-3-[[4-(methylamino)thieno[2,3-d]pyrimidin-2-yl]methyl]pyrimidin-4-one.
| Compound Name | 5-iodo-6-methyl-3-[[4-(methylamino)thieno[2,3-d]pyrimidin-2-yl]methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 66340892 |
| Molecular Formula | C13H12IN5OS |
| Molecular Weight | 413.24 g/mol |
| Exact Mass | 412.98 |
| IUPAC Name | 5-iodo-6-methyl-3-[[4-(methylamino)thieno[2,3-d]pyrimidin-2-yl]methyl]pyrimidin-4-one |
| SMILES | CNc1nc(Cn2cnc(C)c(I)c2=O)nc2sccc12 |
| InChI | InChI=1S/C13H12IN5OS/c1-7-10(14)13(20)19(6-16-7)5-9-17-11(15-2)8-3-4-21-12(8)18-9/h3-4,6H,5H2,1-2H3,(H,15,17,18) |
| InChIKey | KPPDJOKDLIQVAS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|