C12H12ClIN4O — CID 66340017
3-[[3-chloro-6-(methylamino)-2-pyridinyl]methyl]-5-iodo-6-methylpyrimidin-4-one (PubChem CID 66340017) has the molecular formula C12H12ClIN4O and a molecular weight of 390.61 g/mol. Its IUPAC name is 3-[[3-chloro-6-(methylamino)-2-pyridinyl]methyl]-5-iodo-6-methylpyrimidin-4-one.
| Compound Name | 3-[[3-chloro-6-(methylamino)-2-pyridinyl]methyl]-5-iodo-6-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 66340017 |
| Molecular Formula | C12H12ClIN4O |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | 3-[[3-chloro-6-(methylamino)-2-pyridinyl]methyl]-5-iodo-6-methylpyrimidin-4-one |
| SMILES | CNc1ccc(Cl)c(Cn2cnc(C)c(I)c2=O)n1 |
| InChI | InChI=1S/C12H12ClIN4O/c1-7-11(14)12(19)18(6-16-7)5-9-8(13)3-4-10(15-2)17-9/h3-4,6H,5H2,1-2H3,(H,15,17) |
| InChIKey | IPNQWRXQTRRFSB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|