C9H15ClN2 — CID 62349846
1-(4-chlorobutyl)-4,5-dimethylimidazole (PubChem CID 62349846) has the molecular formula C9H15ClN2 and a molecular weight of 186.69 g/mol. Its IUPAC name is 1-(4-chlorobutyl)-4,5-dimethylimidazole.
| Compound Name | 1-(4-chlorobutyl)-4,5-dimethylimidazole |
|---|---|
| PubChem CID | 62349846 |
| Molecular Formula | C9H15ClN2 |
| Molecular Weight | 186.69 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 1-(4-chlorobutyl)-4,5-dimethylimidazole |
| SMILES | Cc1ncn(CCCCCl)c1C |
| InChI | InChI=1S/C9H15ClN2/c1-8-9(2)12(7-11-8)6-4-3-5-10/h7H,3-6H2,1-2H3 |
| InChIKey | NETHJOQLILLGAW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.69 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|