C15H28N2 — CID 116621792
1-decyl-4,5-dimethylimidazole (PubChem CID 116621792) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is 1-decyl-4,5-dimethylimidazole.
| Compound Name | 1-decyl-4,5-dimethylimidazole |
|---|---|
| PubChem CID | 116621792 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | 1-decyl-4,5-dimethylimidazole |
| SMILES | CCCCCCCCCCn1cnc(C)c1C |
| InChI | InChI=1S/C15H28N2/c1-4-5-6-7-8-9-10-11-12-17-13-16-14(2)15(17)3/h13H,4-12H2,1-3H3 |
| InChIKey | MEJDPZRJDYISAX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|