C8H14N2O — CID 54406098
1-(2-methoxyethyl)-4,5-dimethylimidazole (PubChem CID 54406098) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-4,5-dimethylimidazole.
| Compound Name | 1-(2-methoxyethyl)-4,5-dimethylimidazole |
|---|---|
| PubChem CID | 54406098 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 1-(2-methoxyethyl)-4,5-dimethylimidazole |
| SMILES | COCCn1cnc(C)c1C |
| InChI | InChI=1S/C8H14N2O/c1-7-8(2)10(6-9-7)4-5-11-3/h6H,4-5H2,1-3H3 |
| InChIKey | UJYLMXKXBHQWRC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |