C13H16KNO3 — CID 101304473
potassium 3-benzamidohexanoate (PubChem CID 101304473) has the molecular formula C13H16KNO3 and a molecular weight of 273.37 g/mol. Its IUPAC name is potassium 3-benzamidohexanoate.
| Compound Name | potassium 3-benzamidohexanoate |
|---|---|
| PubChem CID | 101304473 |
| Molecular Formula | C13H16KNO3 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | potassium 3-benzamidohexanoate |
| SMILES | CCCC(CC(=O)[O-])NC(=O)c1ccccc1.[K+] |
| InChI | InChI=1S/C13H17NO3.K/c1-2-6-11(9-12(15)16)14-13(17)10-7-4-3-5-8-10;/h3-5,7-8,11H,2,6,9H2,1H3,(H,14,17)(H,15,16);/q;+1/p-1 |
| InChIKey | KHUNGNPNMWEUQP-UHFFFAOYSA-M |
| XLogP | -2.27 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |