C26H46NO3P — CID 68742086
(2S)-2-benzamidopropanoate;tetrabutylphosphanium (PubChem CID 68742086) has the molecular formula C26H46NO3P and a molecular weight of 451.63 g/mol. Its IUPAC name is (2S)-2-benzamidopropanoate;tetrabutylphosphanium.
| Compound Name | (2S)-2-benzamidopropanoate;tetrabutylphosphanium |
|---|---|
| PubChem CID | 68742086 |
| Molecular Formula | C26H46NO3P |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.32 |
| IUPAC Name | (2S)-2-benzamidopropanoate;tetrabutylphosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCC.C[C@H](NC(=O)c1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C16H36P.C10H11NO3/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-7(10(13)14)11-9(12)8-5-3-2-4-6-8/h5-16H2,1-4H3;2-7H,1H3,(H,11,12)(H,13,14)/q+1;/p-1/t;7-/m.0/s1 |
| InChIKey | YWMVIXRVDXTEFL-ZLTKDMPESA-M |
| XLogP | 5.76 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|