C27H37F3N2O5S — CID 68743029
[3-carboxy-2-[[5-[2-(4-pentylphenyl)ethyl]thiophene-2-carbonyl]amino]propyl]-trimethylazanium;2,2,2-trifluoroacetate (PubChem CID 68743029) has the molecular formula C27H37F3N2O5S and a molecular weight of 558.66 g/mol. Its IUPAC name is [3-carboxy-2-[[5-[2-(4-pentylphenyl)ethyl]thiophene-2-carbonyl]amino]propyl]-trimethylazanium;2,2,2-trifluoroacetate.
| Compound Name | [3-carboxy-2-[[5-[2-(4-pentylphenyl)ethyl]thiophene-2-carbonyl]amino]propyl]-trimethylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68743029 |
| Molecular Formula | C27H37F3N2O5S |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | [3-carboxy-2-[[5-[2-(4-pentylphenyl)ethyl]thiophene-2-carbonyl]amino]propyl]-trimethylazanium;2,2,2-trifluoroacetate |
| SMILES | CCCCCc1ccc(CCc2ccc(C(=O)NC(CC(=O)O)C[N+](C)(C)C)s2)cc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C25H36N2O3S.C2HF3O2/c1-5-6-7-8-19-9-11-20(12-10-19)13-14-22-15-16-23(31-22)25(30)26-21(17-24(28)29)18-27(2,3)4;3-2(4,5)1(6)7/h9-12,15-16,21H,5-8,13-14,17-18H2,1-4H3,(H-,26,28,29,30);(H,6,7) |
| InChIKey | OPWQYCMCTAGGAU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|