C24H41N2O3+ — CID 68994195
[3-carboxy-2-(11-phenylundecanoylamino)propyl]-trimethylazanium (PubChem CID 68994195) has the molecular formula C24H41N2O3+ and a molecular weight of 405.60 g/mol. Its IUPAC name is [3-carboxy-2-(11-phenylundecanoylamino)propyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-(11-phenylundecanoylamino)propyl]-trimethylazanium |
|---|---|
| PubChem CID | 68994195 |
| Molecular Formula | C24H41N2O3+ |
| Molecular Weight | 405.60 g/mol |
| Exact Mass | 405.31 |
| IUPAC Name | [3-carboxy-2-(11-phenylundecanoylamino)propyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(CC(=O)O)NC(=O)CCCCCCCCCCc1ccccc1 |
| InChI | InChI=1S/C24H40N2O3/c1-26(2,3)20-22(19-24(28)29)25-23(27)18-14-9-7-5-4-6-8-11-15-21-16-12-10-13-17-21/h10,12-13,16-17,22H,4-9,11,14-15,18-20H2,1-3H3,(H-,25,27,28,29)/p+1 |
| InChIKey | UTBICJFYZKNVHV-UHFFFAOYSA-O |
| XLogP | 4.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|