C22H36FN2O4+ — CID 66910868
[3-carboxy-2-[8-[(4-fluorophenyl)methoxy]octanoylamino]propyl]-trimethylazanium (PubChem CID 66910868) has the molecular formula C22H36FN2O4+ and a molecular weight of 411.54 g/mol. Its IUPAC name is [3-carboxy-2-[8-[(4-fluorophenyl)methoxy]octanoylamino]propyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[8-[(4-fluorophenyl)methoxy]octanoylamino]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 66910868 |
| Molecular Formula | C22H36FN2O4+ |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.27 |
| IUPAC Name | [3-carboxy-2-[8-[(4-fluorophenyl)methoxy]octanoylamino]propyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(CC(=O)O)NC(=O)CCCCCCCOCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H35FN2O4/c1-25(2,3)16-20(15-22(27)28)24-21(26)9-7-5-4-6-8-14-29-17-18-10-12-19(23)13-11-18/h10-13,20H,4-9,14-17H2,1-3H3,(H-,24,26,27,28)/p+1 |
| InChIKey | ZLDLJWBGTQRNTC-UHFFFAOYSA-O |
| XLogP | 3.35 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|