C23H38N2O5 — CID 66910892
3-[8-[(4-methoxyphenyl)methoxy]octanoylamino]-4-(trimethylazaniumyl)butanoate (PubChem CID 66910892) has the molecular formula C23H38N2O5 and a molecular weight of 422.57 g/mol. Its IUPAC name is 3-[8-[(4-methoxyphenyl)methoxy]octanoylamino]-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[8-[(4-methoxyphenyl)methoxy]octanoylamino]-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 66910892 |
| Molecular Formula | C23H38N2O5 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | 3-[8-[(4-methoxyphenyl)methoxy]octanoylamino]-4-(trimethylazaniumyl)butanoate |
| SMILES | COc1ccc(COCCCCCCCC(=O)NC(CC(=O)[O-])C[N+](C)(C)C)cc1 |
| InChI | InChI=1S/C23H38N2O5/c1-25(2,3)17-20(16-23(27)28)24-22(26)10-8-6-5-7-9-15-30-18-19-11-13-21(29-4)14-12-19/h11-14,20H,5-10,15-18H2,1-4H3,(H-,24,26,27,28) |
| InChIKey | HBCVZHLRMOOWIP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|