C29H42N2O5 — CID 66875118
benzyl 4-(dimethylamino)-3-[8-[(4-methoxyphenyl)methoxy]octanoylamino]butanoate (PubChem CID 66875118) has the molecular formula C29H42N2O5 and a molecular weight of 498.66 g/mol. Its IUPAC name is benzyl 4-(dimethylamino)-3-[8-[(4-methoxyphenyl)methoxy]octanoylamino]butanoate.
| Compound Name | benzyl 4-(dimethylamino)-3-[8-[(4-methoxyphenyl)methoxy]octanoylamino]butanoate |
|---|---|
| PubChem CID | 66875118 |
| Molecular Formula | C29H42N2O5 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.31 |
| IUPAC Name | benzyl 4-(dimethylamino)-3-[8-[(4-methoxyphenyl)methoxy]octanoylamino]butanoate |
| SMILES | COc1ccc(COCCCCCCCC(=O)NC(CC(=O)OCc2ccccc2)CN(C)C)cc1 |
| InChI | InChI=1S/C29H42N2O5/c1-31(2)21-26(20-29(33)36-23-24-12-8-7-9-13-24)30-28(32)14-10-5-4-6-11-19-35-22-25-15-17-27(34-3)18-16-25/h7-9,12-13,15-18,26H,4-6,10-11,14,19-23H2,1-3H3,(H,30,32) |
| InChIKey | PVKSKJMKLZIFIX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|