C28H35F5N2O4 — CID 66875645
benzyl (3R)-3-[8-[difluoro-(2,3,4-trifluorophenyl)methoxy]octanoylamino]-4-(dimethylamino)butanoate (PubChem CID 66875645) has the molecular formula C28H35F5N2O4 and a molecular weight of 558.59 g/mol. Its IUPAC name is benzyl (3R)-3-[8-[difluoro-(2,3,4-trifluorophenyl)methoxy]octanoylamino]-4-(dimethylamino)butanoate.
| Compound Name | benzyl (3R)-3-[8-[difluoro-(2,3,4-trifluorophenyl)methoxy]octanoylamino]-4-(dimethylamino)butanoate |
|---|---|
| PubChem CID | 66875645 |
| Molecular Formula | C28H35F5N2O4 |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | benzyl (3R)-3-[8-[difluoro-(2,3,4-trifluorophenyl)methoxy]octanoylamino]-4-(dimethylamino)butanoate |
| SMILES | CN(C)C[C@@H](CC(=O)OCc1ccccc1)NC(=O)CCCCCCCOC(F)(F)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C28H35F5N2O4/c1-35(2)18-21(17-25(37)38-19-20-11-7-6-8-12-20)34-24(36)13-9-4-3-5-10-16-39-28(32,33)22-14-15-23(29)27(31)26(22)30/h6-8,11-12,14-15,21H,3-5,9-10,13,16-19H2,1-2H3,(H,34,36)/t21-/m1/s1 |
| InChIKey | AZESFVOSVQFTTR-OAQYLSRUSA-N |
| XLogP | 5.69 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|