C29H39FN2O3 — CID 66874518
benzyl (3R)-4-(dimethylamino)-3-[10-(3-fluorophenyl)dec-9-enoylamino]butanoate (PubChem CID 66874518) has the molecular formula C29H39FN2O3 and a molecular weight of 482.64 g/mol. Its IUPAC name is benzyl (3R)-4-(dimethylamino)-3-[10-(3-fluorophenyl)dec-9-enoylamino]butanoate.
| Compound Name | benzyl (3R)-4-(dimethylamino)-3-[10-(3-fluorophenyl)dec-9-enoylamino]butanoate |
|---|---|
| PubChem CID | 66874518 |
| Molecular Formula | C29H39FN2O3 |
| Molecular Weight | 482.64 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | benzyl (3R)-4-(dimethylamino)-3-[10-(3-fluorophenyl)dec-9-enoylamino]butanoate |
| SMILES | CN(C)C[C@@H](CC(=O)OCc1ccccc1)NC(=O)CCCCCCCC=Cc1cccc(F)c1 |
| InChI | InChI=1S/C29H39FN2O3/c1-32(2)22-27(21-29(34)35-23-25-15-10-8-11-16-25)31-28(33)19-12-7-5-3-4-6-9-14-24-17-13-18-26(30)20-24/h8-11,13-18,20,27H,3-7,12,19,21-23H2,1-2H3,(H,31,33)/t27-/m1/s1 |
| InChIKey | DWWUMKBTHPFGMK-HHHXNRCGSA-N |
| XLogP | 5.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.64 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|