C29H38F2N2O3 — CID 66875147
benzyl 3-[10-(2,3-difluorophenyl)dec-9-enoylamino]-4-(dimethylamino)butanoate (PubChem CID 66875147) has the molecular formula C29H38F2N2O3 and a molecular weight of 500.63 g/mol. Its IUPAC name is benzyl 3-[10-(2,3-difluorophenyl)dec-9-enoylamino]-4-(dimethylamino)butanoate.
| Compound Name | benzyl 3-[10-(2,3-difluorophenyl)dec-9-enoylamino]-4-(dimethylamino)butanoate |
|---|---|
| PubChem CID | 66875147 |
| Molecular Formula | C29H38F2N2O3 |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | benzyl 3-[10-(2,3-difluorophenyl)dec-9-enoylamino]-4-(dimethylamino)butanoate |
| SMILES | CN(C)CC(CC(=O)OCc1ccccc1)NC(=O)CCCCCCCC=Cc1cccc(F)c1F |
| InChI | InChI=1S/C29H38F2N2O3/c1-33(2)21-25(20-28(35)36-22-23-14-9-8-10-15-23)32-27(34)19-12-7-5-3-4-6-11-16-24-17-13-18-26(30)29(24)31/h8-11,13-18,25H,3-7,12,19-22H2,1-2H3,(H,32,34) |
| InChIKey | MSLQQZPKFOYRNQ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|