C29H38F4N2O4 — CID 66875229
benzyl 4-(dimethylamino)-3-[8-[[3-fluoro-4-(trifluoromethyl)phenyl]methoxy]octanoylamino]butanoate (PubChem CID 66875229) has the molecular formula C29H38F4N2O4 and a molecular weight of 554.63 g/mol. Its IUPAC name is benzyl 4-(dimethylamino)-3-[8-[[3-fluoro-4-(trifluoromethyl)phenyl]methoxy]octanoylamino]butanoate.
| Compound Name | benzyl 4-(dimethylamino)-3-[8-[[3-fluoro-4-(trifluoromethyl)phenyl]methoxy]octanoylamino]butanoate |
|---|---|
| PubChem CID | 66875229 |
| Molecular Formula | C29H38F4N2O4 |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | benzyl 4-(dimethylamino)-3-[8-[[3-fluoro-4-(trifluoromethyl)phenyl]methoxy]octanoylamino]butanoate |
| SMILES | CN(C)CC(CC(=O)OCc1ccccc1)NC(=O)CCCCCCCOCc1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C29H38F4N2O4/c1-35(2)19-24(18-28(37)39-21-22-11-7-6-8-12-22)34-27(36)13-9-4-3-5-10-16-38-20-23-14-15-25(26(30)17-23)29(31,32)33/h6-8,11-12,14-15,17,24H,3-5,9-10,13,16,18-21H2,1-2H3,(H,34,36) |
| InChIKey | ALWMVTWUBSUFLB-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|