C31H44N2O3 — CID 66875201
benzyl 4-(dimethylamino)-3-[10-(2,6-dimethylphenyl)dec-9-enoylamino]butanoate (PubChem CID 66875201) has the molecular formula C31H44N2O3 and a molecular weight of 492.70 g/mol. Its IUPAC name is benzyl 4-(dimethylamino)-3-[10-(2,6-dimethylphenyl)dec-9-enoylamino]butanoate.
| Compound Name | benzyl 4-(dimethylamino)-3-[10-(2,6-dimethylphenyl)dec-9-enoylamino]butanoate |
|---|---|
| PubChem CID | 66875201 |
| Molecular Formula | C31H44N2O3 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.34 |
| IUPAC Name | benzyl 4-(dimethylamino)-3-[10-(2,6-dimethylphenyl)dec-9-enoylamino]butanoate |
| SMILES | Cc1cccc(C)c1C=CCCCCCCCC(=O)NC(CC(=O)OCc1ccccc1)CN(C)C |
| InChI | InChI=1S/C31H44N2O3/c1-25-16-15-17-26(2)29(25)20-13-8-6-5-7-9-14-21-30(34)32-28(23-33(3)4)22-31(35)36-24-27-18-11-10-12-19-27/h10-13,15-20,28H,5-9,14,21-24H2,1-4H3,(H,32,34) |
| InChIKey | YKHPGYPGCJVZOL-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|