C36H41N3O5 — CID 139821432
benzyl (4R)-4-[10-(3-cyanophenyl)dec-9-enoylamino]-5-oxo-5-(phenylmethoxyamino)pentanoate (PubChem CID 139821432) has the molecular formula C36H41N3O5 and a molecular weight of 595.74 g/mol. Its IUPAC name is benzyl (4R)-4-[10-(3-cyanophenyl)dec-9-enoylamino]-5-oxo-5-(phenylmethoxyamino)pentanoate.
| Compound Name | benzyl (4R)-4-[10-(3-cyanophenyl)dec-9-enoylamino]-5-oxo-5-(phenylmethoxyamino)pentanoate |
|---|---|
| PubChem CID | 139821432 |
| Molecular Formula | C36H41N3O5 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.30 |
| IUPAC Name | benzyl (4R)-4-[10-(3-cyanophenyl)dec-9-enoylamino]-5-oxo-5-(phenylmethoxyamino)pentanoate |
| SMILES | N#Cc1cccc(C=CCCCCCCCC(=O)N[C@H](CCC(=O)OCc2ccccc2)C(=O)NOCc2ccccc2)c1 |
| InChI | InChI=1S/C36H41N3O5/c37-26-32-21-14-20-29(25-32)15-8-4-2-1-3-5-13-22-34(40)38-33(36(42)39-44-28-31-18-11-7-12-19-31)23-24-35(41)43-27-30-16-9-6-10-17-30/h6-12,14-21,25,33H,1-5,13,22-24,27-28H2,(H,38,40)(H,39,42)/t33-/m1/s1 |
| InChIKey | FXJBZTBTYKNTAJ-MGBGTMOVSA-N |
| XLogP | 6.56 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|