C27H34N4O5 — CID 142932524
benzyl (7S)-8-(2-amino-4-cyanoanilino)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxooctanoate (PubChem CID 142932524) has the molecular formula C27H34N4O5 and a molecular weight of 494.59 g/mol. Its IUPAC name is benzyl (7S)-8-(2-amino-4-cyanoanilino)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxooctanoate.
| Compound Name | benzyl (7S)-8-(2-amino-4-cyanoanilino)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxooctanoate |
|---|---|
| PubChem CID | 142932524 |
| Molecular Formula | C27H34N4O5 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | benzyl (7S)-8-(2-amino-4-cyanoanilino)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxooctanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCCC(=O)OCc1ccccc1)C(=O)Nc1ccc(C#N)cc1N |
| InChI | InChI=1S/C27H34N4O5/c1-27(2,3)36-26(34)31-23(25(33)30-22-15-14-20(17-28)16-21(22)29)12-8-5-9-13-24(32)35-18-19-10-6-4-7-11-19/h4,6-7,10-11,14-16,23H,5,8-9,12-13,18,29H2,1-3H3,(H,30,33)(H,31,34)/t23-/m0/s1 |
| InChIKey | KRPNPSZTIGVQMX-QHCPKHFHSA-N |
| XLogP | 4.67 |
| TPSA | 143.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|