C27H38N2O3S — CID 66874546
benzyl 4-(dimethylamino)-3-(10-thiophen-3-yldec-9-enoylamino)butanoate (PubChem CID 66874546) has the molecular formula C27H38N2O3S and a molecular weight of 470.68 g/mol. Its IUPAC name is benzyl 4-(dimethylamino)-3-(10-thiophen-3-yldec-9-enoylamino)butanoate.
| Compound Name | benzyl 4-(dimethylamino)-3-(10-thiophen-3-yldec-9-enoylamino)butanoate |
|---|---|
| PubChem CID | 66874546 |
| Molecular Formula | C27H38N2O3S |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | benzyl 4-(dimethylamino)-3-(10-thiophen-3-yldec-9-enoylamino)butanoate |
| SMILES | CN(C)CC(CC(=O)OCc1ccccc1)NC(=O)CCCCCCCC=Cc1ccsc1 |
| InChI | InChI=1S/C27H38N2O3S/c1-29(2)20-25(19-27(31)32-21-23-13-10-8-11-14-23)28-26(30)16-12-7-5-3-4-6-9-15-24-17-18-33-22-24/h8-11,13-15,17-18,22,25H,3-7,12,16,19-21H2,1-2H3,(H,28,30) |
| InChIKey | YMZRTHLJUJRNQW-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|