C22H32F5N2O4+ — CID 66910851
[(2R)-3-carboxy-2-[8-[difluoro-(2,3,4-trifluorophenyl)methoxy]octanoylamino]propyl]-trimethylazanium (PubChem CID 66910851) has the molecular formula C22H32F5N2O4+ and a molecular weight of 483.50 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[8-[difluoro-(2,3,4-trifluorophenyl)methoxy]octanoylamino]propyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-2-[8-[difluoro-(2,3,4-trifluorophenyl)methoxy]octanoylamino]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 66910851 |
| Molecular Formula | C22H32F5N2O4+ |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | [(2R)-3-carboxy-2-[8-[difluoro-(2,3,4-trifluorophenyl)methoxy]octanoylamino]propyl]-trimethylazanium |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)O)NC(=O)CCCCCCCOC(F)(F)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C22H31F5N2O4/c1-29(2,3)14-15(13-19(31)32)28-18(30)9-7-5-4-6-8-12-33-22(26,27)16-10-11-17(23)21(25)20(16)24/h10-11,15H,4-9,12-14H2,1-3H3,(H-,28,30,31,32)/p+1/t15-/m1/s1 |
| InChIKey | COMNNURBOPUYBW-OAHLLOKOSA-O |
| XLogP | 4.18 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|