C19H24FN2O4S+ — CID 91579486
[3-carboxy-2-[[4-(4-fluorophenyl)phenyl]sulfonylamino]propyl]-trimethylazanium (PubChem CID 91579486) has the molecular formula C19H24FN2O4S+ and a molecular weight of 395.48 g/mol. Its IUPAC name is [3-carboxy-2-[[4-(4-fluorophenyl)phenyl]sulfonylamino]propyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[[4-(4-fluorophenyl)phenyl]sulfonylamino]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 91579486 |
| Molecular Formula | C19H24FN2O4S+ |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | [3-carboxy-2-[[4-(4-fluorophenyl)phenyl]sulfonylamino]propyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(CC(=O)O)NS(=O)(=O)c1ccc(-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H23FN2O4S/c1-22(2,3)13-17(12-19(23)24)21-27(25,26)18-10-6-15(7-11-18)14-4-8-16(20)9-5-14/h4-11,17,21H,12-13H2,1-3H3/p+1 |
| InChIKey | LUAORJCUTRQMDC-UHFFFAOYSA-O |
| XLogP | 2.32 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|