C17H27FN2O4S — CID 22221660
2-[(4-fluorophenyl)sulfonylamino]-N-(1-hydroxy-4-methylpentan-2-yl)-3-methylbutanamide (PubChem CID 22221660) has the molecular formula C17H27FN2O4S and a molecular weight of 374.48 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)sulfonylamino]-N-(1-hydroxy-4-methylpentan-2-yl)-3-methylbutanamide.
| Compound Name | 2-[(4-fluorophenyl)sulfonylamino]-N-(1-hydroxy-4-methylpentan-2-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 22221660 |
| Molecular Formula | C17H27FN2O4S |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2-[(4-fluorophenyl)sulfonylamino]-N-(1-hydroxy-4-methylpentan-2-yl)-3-methylbutanamide |
| SMILES | CC(C)CC(CO)NC(=O)C(NS(=O)(=O)c1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C17H27FN2O4S/c1-11(2)9-14(10-21)19-17(22)16(12(3)4)20-25(23,24)15-7-5-13(18)6-8-15/h5-8,11-12,14,16,20-21H,9-10H2,1-4H3,(H,19,22) |
| InChIKey | IBRVWKVLICVNRM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |