C20H24F3N3O7S — CID 68744020
[(2R)-3-carboxy-2-[(6-phenoxy-3-pyridinyl)sulfonylamino]propyl]-trimethylazanium;2,2,2-trifluoroacetate (PubChem CID 68744020) has the molecular formula C20H24F3N3O7S and a molecular weight of 507.49 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[(6-phenoxy-3-pyridinyl)sulfonylamino]propyl]-trimethylazanium;2,2,2-trifluoroacetate.
| Compound Name | [(2R)-3-carboxy-2-[(6-phenoxy-3-pyridinyl)sulfonylamino]propyl]-trimethylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68744020 |
| Molecular Formula | C20H24F3N3O7S |
| Molecular Weight | 507.49 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | [(2R)-3-carboxy-2-[(6-phenoxy-3-pyridinyl)sulfonylamino]propyl]-trimethylazanium;2,2,2-trifluoroacetate |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)O)NS(=O)(=O)c1ccc(Oc2ccccc2)nc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C18H23N3O5S.C2HF3O2/c1-21(2,3)13-14(11-18(22)23)20-27(24,25)16-9-10-17(19-12-16)26-15-7-5-4-6-8-15;3-2(4,5)1(6)7/h4-10,12,14,20H,11,13H2,1-3H3;(H,6,7)/t14-;/m1./s1 |
| InChIKey | IKIJNGIIPVUVAX-PFEQFJNWSA-N |
| XLogP | 1.00 |
| TPSA | 145.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.49 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|