C19H32N2O5S — CID 89472685
(3S)-3-[(4-octoxyphenyl)sulfamoylamino]pentanoic acid (PubChem CID 89472685) has the molecular formula C19H32N2O5S and a molecular weight of 400.54 g/mol. Its IUPAC name is (3S)-3-[(4-octoxyphenyl)sulfamoylamino]pentanoic acid.
| Compound Name | (3S)-3-[(4-octoxyphenyl)sulfamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 89472685 |
| Molecular Formula | C19H32N2O5S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | (3S)-3-[(4-octoxyphenyl)sulfamoylamino]pentanoic acid |
| SMILES | CCCCCCCCOc1ccc(NS(=O)(=O)N[C@@H](CC)CC(=O)O)cc1 |
| InChI | InChI=1S/C19H32N2O5S/c1-3-5-6-7-8-9-14-26-18-12-10-17(11-13-18)21-27(24,25)20-16(4-2)15-19(22)23/h10-13,16,20-21H,3-9,14-15H2,1-2H3,(H,22,23)/t16-/m0/s1 |
| InChIKey | LZVMRZNVCJRSOH-INIZCTEOSA-N |
| XLogP | 3.93 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|