C20H20F2N4O4 — CID 173251422
[[4-(4-methanehydrazonoylanilino)-4-oxobutanoyl]amino] 2-(3,4-difluorophenyl)propanoate (PubChem CID 173251422) has the molecular formula C20H20F2N4O4 and a molecular weight of 418.40 g/mol. Its IUPAC name is [[4-(4-methanehydrazonoylanilino)-4-oxobutanoyl]amino] 2-(3,4-difluorophenyl)propanoate.
| Compound Name | [[4-(4-methanehydrazonoylanilino)-4-oxobutanoyl]amino] 2-(3,4-difluorophenyl)propanoate |
|---|---|
| PubChem CID | 173251422 |
| Molecular Formula | C20H20F2N4O4 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | [[4-(4-methanehydrazonoylanilino)-4-oxobutanoyl]amino] 2-(3,4-difluorophenyl)propanoate |
| SMILES | CC(C(=O)ONC(=O)CCC(=O)Nc1ccc(C=NN)cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H20F2N4O4/c1-12(14-4-7-16(21)17(22)10-14)20(29)30-26-19(28)9-8-18(27)25-15-5-2-13(3-6-15)11-24-23/h2-7,10-12H,8-9,23H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | VCDRSQSKTKGYTQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|