C21H30N4O4Si — CID 70061349
ethyl 3-[[4-(4-methanehydrazonoylanilino)-4-oxobutanoyl]amino]-5-trimethylsilylpent-4-ynoate (PubChem CID 70061349) has the molecular formula C21H30N4O4Si and a molecular weight of 430.58 g/mol. Its IUPAC name is ethyl 3-[[4-(4-methanehydrazonoylanilino)-4-oxobutanoyl]amino]-5-trimethylsilylpent-4-ynoate.
| Compound Name | ethyl 3-[[4-(4-methanehydrazonoylanilino)-4-oxobutanoyl]amino]-5-trimethylsilylpent-4-ynoate |
|---|---|
| PubChem CID | 70061349 |
| Molecular Formula | C21H30N4O4Si |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | ethyl 3-[[4-(4-methanehydrazonoylanilino)-4-oxobutanoyl]amino]-5-trimethylsilylpent-4-ynoate |
| SMILES | CCOC(=O)CC(C#C[Si](C)(C)C)NC(=O)CCC(=O)Nc1ccc(C=NN)cc1 |
| InChI | InChI=1S/C21H30N4O4Si/c1-5-29-21(28)14-18(12-13-30(2,3)4)25-20(27)11-10-19(26)24-17-8-6-16(7-9-17)15-23-22/h6-9,15,18H,5,10-11,14,22H2,1-4H3,(H,24,26)(H,25,27) |
| InChIKey | LHRXTHWMKXZEFF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|