C17H24N2O4 — CID 17193984
ethyl 4-[4-(3-methylbutanoylamino)anilino]-4-oxobutanoate (PubChem CID 17193984) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is ethyl 4-[4-(3-methylbutanoylamino)anilino]-4-oxobutanoate.
| Compound Name | ethyl 4-[4-(3-methylbutanoylamino)anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 17193984 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | ethyl 4-[4-(3-methylbutanoylamino)anilino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)Nc1ccc(NC(=O)CC(C)C)cc1 |
| InChI | InChI=1S/C17H24N2O4/c1-4-23-17(22)10-9-15(20)18-13-5-7-14(8-6-13)19-16(21)11-12(2)3/h5-8,12H,4,9-11H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | DFHIUKSOCSKZFQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |