C22H29NO8 — CID 124632181
diethyl (3S)-3-[4-(4-methoxyanilino)-4-oxobutanoyl]-4-oxoheptanedioate (PubChem CID 124632181) has the molecular formula C22H29NO8 and a molecular weight of 435.47 g/mol. Its IUPAC name is diethyl (3S)-3-[4-(4-methoxyanilino)-4-oxobutanoyl]-4-oxoheptanedioate.
| Compound Name | diethyl (3S)-3-[4-(4-methoxyanilino)-4-oxobutanoyl]-4-oxoheptanedioate |
|---|---|
| PubChem CID | 124632181 |
| Molecular Formula | C22H29NO8 |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | diethyl (3S)-3-[4-(4-methoxyanilino)-4-oxobutanoyl]-4-oxoheptanedioate |
| SMILES | CCOC(=O)CCC(=O)[C@@H](CC(=O)OCC)C(=O)CCC(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H29NO8/c1-4-30-21(27)13-11-19(25)17(14-22(28)31-5-2)18(24)10-12-20(26)23-15-6-8-16(29-3)9-7-15/h6-9,17H,4-5,10-14H2,1-3H3,(H,23,26)/t17-/m0/s1 |
| InChIKey | RCNGFUWOYWXVEF-KRWDZBQOSA-N |
| XLogP | 2.46 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|